NSC131925
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-09-06T09:04:34Z | |
dc.date.available | 2005-09-06T09:04:34Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-09-06T09:04:34Z | |
dc.identifier | NSC131925 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/104682 | |
dc.format.extent | 7374 bytes | |
dc.format.extent | 6395 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC131925 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | OGCWWDABZKNGEP-LESCFKLSSA-N | |
dc.identifier.inchi | InChI=1S/C17H19N5O5S/c23-6-10-12(24)13(25)16(27-10)22-8-18-11-14(22)19-17(21-26)20-15(11)28-7-9-4-2-1-3-5-9/h1-5,8,10,12-13,16,23-26H,6-7H2,(H,19,20,21)/t10-,12+,13+,16+/m1/s1 | |
dc.identifier.ichi | C17H19N5O5S,23H-8H2-14H-15H(24H)16H(25H)17H(27-14)22-6H-18-10-11(19-13(20-26H)21H-12(10)22)28-7H2-9-4H-2H-1H-3H-5H-9 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules