NSC131976
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-09-06T09:11:09Z | |
dc.date.available | 2005-09-06T09:11:09Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-09-06T09:11:09Z | |
dc.identifier | NSC131976 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/104733 | |
dc.format.extent | 5347 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC131976 | en_GB |
dc.title.alternative | Carbanilide, N-ethylthio- (8CI) | en_GB |
dc.title.alternative | N-Ethyl-N,N'-diphenylthiourea | en_GB |
dc.title.alternative | Thiourea, N-ethyl-N,N'-diphenyl- (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | CGUZBKOFKLEPPX-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C15H16N2S/c1-2-17(14-11-7-4-8-12-14)15(18)16-13-9-5-3-6-10-13/h3-12H,2H2,1H3,(H,16,18) | |
dc.identifier.ichi | C15H16N2S,1H3-12H2-17(14-10H-6H-3H-7H-11H-14)15(18)16H-13-8H-4H-2H-5H-9H-13 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules