NSC134770
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2006-01-11T17:11:23Z | |
| dc.date.available | 2006-01-11T17:11:23Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2006-01-11T17:11:23Z | |
| dc.identifier | NSC134770 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/106681 | |
| dc.format.extent | 2478 bytes | |
| dc.format.extent | 3278 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC134770 | en_GB |
| dc.title.alternative | 2(3H)-Furanone, dihydro-4-methyl- (8CI9CI) | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | ALZLTHLQMAFAPA-BYPYZUCNSA-N | |
| dc.identifier.inchi | InChI=1S/C5H8O2/c1-4-2-5(6)7-3-4/h4H,2-3H2,1H3/t4-/m0/s1 | |
| dc.identifier.ichi | C5H8O2,1H3-5H-2H2-4(6)7-3H2-5 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules