NSC136617
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2006-01-12T10:15:36Z | |
| dc.date.available | 2006-01-12T10:15:36Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2006-01-12T10:15:36Z | |
| dc.identifier | NSC136617 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/107824 | |
| dc.format.extent | 2436 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC136617 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | VPJDULFXCAQHRC-UHFFFAOYSA-N | |
| dc.identifier.inchi | InChI=1S/C4H8N2O/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) | |
| dc.identifier.ichi | C4H8N2O,1H2-2H-3H2-6H-4(5H2)7 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules