NSC140380
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-12T15:34:17Z | |
dc.date.available | 2006-01-12T15:34:17Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-12T15:34:17Z | |
dc.identifier | NSC140380 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/110122 | |
dc.format.extent | 7709 bytes | |
dc.format.extent | 6722 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC140380 | en_GB |
dc.title.alternative | Ethanesulfonic acid, compd. with 4-[[2-chloro-4-(4,6-diamino-2, 2-dimethyl-1,3,5-triazin-1(2H)-yl)phenoxy]acetyl]morpholine (1:1) (9CI) (MF2) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | UHHOKYHLNSWFNG-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C17H23ClN6O3/c1-17(2)22-15(19)21-16(20)24(17)11-3-4-13(12(18)9-11)27-10-14(25)23-5-7-26-8-6-23/h3-4,9H,5-8,10H2,1-2H3,(H4,19,20,21,22) | |
dc.identifier.ichi | C17H23ClN6O3,1H3-17(2H3)22-15(19H2)21-16(20H2)24(17)11-3H-4H-13(12(18)5H-11)27-10H2-14(25)23-6H2-8H2-26-9H2-7H2-23 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules