NSC140852
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-12T15:50:47Z | |
dc.date.available | 2006-01-12T15:50:47Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-12T15:50:47Z | |
dc.identifier | NSC140852 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/110322 | |
dc.format.extent | 6362 bytes | |
dc.format.extent | 5764 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC140852 | en_GB |
dc.title.alternative | Imidazole-5-carboxamide, 4-(3, 3-dimethyl-1-triazeno)-1-.beta.-D-ribofuranosyl- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NBIGORVXDSPDDH-YCHHRQDNSA-N | |
dc.identifier.inchi | InChI=1S/C11H18N6O5/c1-16(2)15-14-10-6(9(12)21)17(4-13-10)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,18-20H,3H2,1-2H3,(H2,12,21)/b15-14+/t5-,7-,8-,11-/m1/s1 | |
dc.identifier.ichi | C11H18N6O5,1H3-16(2H3)15-14-7-5(6(12H2)18)17(3H-13-7)11H-10H(21H)9H(20H)8H(4H2-19H)22-11 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules