NSC141591
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2006-01-12T17:10:56Z | |
| dc.date.available | 2006-01-12T17:10:56Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2006-01-12T17:10:56Z | |
| dc.identifier | NSC141591 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/110810 | |
| dc.format.extent | 4536 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC141591 | en_GB |
| dc.title.alternative | Imidazo[1,2-f]phenanthridine, 7-chloro-2,3-dihydro- | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | KMDWKSYBWOTXEV-UHFFFAOYSA-N | |
| dc.identifier.inchi | InChI=1S/C15H11ClN2/c16-10-5-6-14-13(9-10)11-3-1-2-4-12(11)15-17-7-8-18(14)15/h1-6,9H,7-8H2 | |
| dc.identifier.ichi | C15H11ClN2,16-10-5H-6H-14-13(7H-10)11-3H-1H-2H-4H-12(11)15-17-8H2-9H2-18(14)15 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules