NSC144074
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-13T11:00:32Z | |
dc.date.available | 2006-01-13T11:00:32Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-13T11:00:32Z | |
dc.identifier | NSC144074 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/112591 | |
dc.format.extent | 3897 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC144074 | en_GB |
dc.title.alternative | Benzoic acid, 2-hydroxy-, compd. with 3,7-dihydro-1,3, 7-trimethyl-1H-purine-2,6-dione (1:1) (9CI) | en_GB |
dc.title.alternative | Caffeine salicylate | en_GB |
dc.title.alternative | Salicylic acid, compd. with caffeine (1:1) (8CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 | |
dc.identifier.ichi | C8H10N4O2,1H3-10-4H-9-6-5(10)7(13)12(3H3)8(14)11(6)2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules