NSC145912
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-13T14:13:16Z | |
dc.date.available | 2006-01-13T14:13:16Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-13T14:13:16Z | |
dc.identifier | NSC145912 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/113237 | |
dc.format.extent | 6990 bytes | |
dc.format.extent | 6377 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC145912 | en_GB |
dc.title.alternative | Flexuosin A | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ROZRLLOAWQAIAR-STVVISHVSA-N | |
dc.identifier.inchi | InChI=1S/C17H24O6/c1-7-5-11-13(8(2)16(21)23-11)15(22-9(3)18)17(4)12(20)6-10(19)14(7)17/h7,10-15,19-20H,2,5-6H2,1,3-4H3/t7-,10+,11+,12+,13-,14+,15+,17+/m1/s1 | |
dc.identifier.ichi | C17H24O6,1H2-7-9(19)23-12H-5H2-10H(3H3)15H-11H(20H)6H2-13H(21H)17(15,4H3)16H(14H(7)12)22-8(2H3)18 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules