NSC241469
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-27T15:52:32Z | |
dc.date.available | 2006-04-27T15:52:32Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-27T15:52:32Z | |
dc.identifier | NSC241469 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/148810 | |
dc.format.extent | 5870 bytes | |
dc.format.extent | 5445 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC241469 | en_GB |
dc.title.alternative | Cyclohexanedicarboximide, N-(2,6-dioxo-3-piperidyl)-, (.+-.)- (8CI) | en_GB |
dc.title.alternative | Glutarimide, 2-(hexahydrophthalimido)- | en_GB |
dc.title.alternative | Hexahydrothalidomide (.+-.)- | en_GB |
dc.title.alternative | 1H-Isoindole-1,3(2H)-dione, 2-(2, 6-dioxo-3-pyridinyl)hexahydro- (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | IWKLKPPKVNKYPD-XHNCKOQMSA-N | |
dc.identifier.inchi | InChI=1S/C13H16N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h7-9H,1-6H2,(H,14,16,17)/t7-,8-,9+/m0/s1 | |
dc.identifier.ichi | C13H16N2O4,16-7-3H2-6H2-13H(8(17)14H-7)15-9(18)11H-4H2-1H2-2H2-5H2-12H(11)10(15)19 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules