NSC241851
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-27T15:59:39Z | |
dc.date.available | 2006-04-27T15:59:39Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-27T15:59:39Z | |
dc.identifier | NSC241851 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/148968 | |
dc.format.extent | 4259 bytes | |
dc.format.extent | 4400 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC241851 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | UOZNYAIYXGTVKD-FPLPWBNLSA-N | |
dc.identifier.inchi | InChI=1S/C12H14S2/c1-2-5-11(6-3-1)7-8-12-13-9-4-10-14-12/h1-3,5-8,12H,4,9-10H2/b8-7- | |
dc.identifier.ichi | C12H14S2,1H-2H-4H-11(5H-3H-1)6H-7H-12H-13-9H2-8H2-10H2-14-12 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules