NSC243183
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-27T16:18:17Z | |
dc.date.available | 2006-04-27T16:18:17Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-27T16:18:17Z | |
dc.identifier | NSC243183 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/149182 | |
dc.format.extent | 4909 bytes | |
dc.format.extent | 4893 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC243183 | en_GB |
dc.title.alternative | p-Toluenesulfinic acid, thio-, S-p-tolyl ester (8CI) | en_GB |
dc.title.alternative | Benzenesulfinothioic acid, 4-methyl-, S-(4-methylphenyl) ester (9CI) | en_GB |
dc.title.alternative | S-p-Tolyl p-toluenethiosulfinate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | DYXUFWJNNVLBRP-KRWDZBQOSA-N | |
dc.identifier.inchi | InChI=1S/C14H14OS2/c1-11-3-7-13(8-4-11)16-17(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3/t17-/m0/s1 | |
dc.identifier.ichi | C14H14OS2,1H3-11-3H-7H-13(8H-4H-11)16-17(15)14-9H-5H-12(2H3)6H-10H-14 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules