NSC243613
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-27T16:25:25Z | |
dc.date.available | 2006-04-27T16:25:25Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-27T16:25:25Z | |
dc.identifier | NSC243613 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/149345 | |
dc.format.extent | 2498 bytes | |
dc.format.extent | 3249 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC243613 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NINSPLAPBBAHEW-ONEGZZNKSA-N | |
dc.identifier.inchi | InChI=1S/C5H8O3/c1-2-8-5(7)3-4-6/h3-4,6H,2H2,1H3/b4-3+ | |
dc.identifier.ichi | C5H8O3,1H3-4H2-8-5(6)2H-3H-7H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules