NSC244897
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-27T16:55:10Z | |
dc.date.available | 2006-04-27T16:55:10Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-27T16:55:10Z | |
dc.identifier | NSC244897 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/149976 | |
dc.format.extent | 2702 bytes | |
dc.format.extent | 3492 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC244897 | en_GB |
dc.title.alternative | 1-Hexyn-4-ol | en_GB |
dc.title.alternative | 5-Hexyn-3-ol (8CI9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | AJYGRAORQSCNED-LURJTMIESA-N | |
dc.identifier.inchi | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h1,6-7H,4-5H2,2H3/t6-/m0/s1 | |
dc.identifier.ichi | C6H10O,1H-3-5H2-6H(7H)4H2-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules