NSC251927
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T12:25:39Z | |
dc.date.available | 2006-04-28T12:25:39Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T12:25:39Z | |
dc.identifier | NSC251927 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/151671 | |
dc.format.extent | 4140 bytes | |
dc.format.extent | 4403 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC251927 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QXUCVJDVEFVHKP-ZCFIWIBFSA-N | |
dc.identifier.inchi | InChI=1S/C10H12N4O/c1-6-2-3-9-7(4-6)13-8(5-11)10(12)14(9)15/h6H,2-4,12H2,1H3/t6-/m1/s1 | |
dc.identifier.ichi | C10H12N4O,1H3-10H-4H2-3H2-8-7(5H2-10)13-6(2-11)9(12H2)14(8)15 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules