NSC254164
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T12:50:26Z | |
dc.date.available | 2006-04-28T12:50:26Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T12:50:26Z | |
dc.identifier | NSC254164 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/152148 | |
dc.format.extent | 11395 bytes | |
dc.format.extent | 9115 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC254164 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | KRCAKIVDAFTTGJ-ARVREXMNSA-N | |
dc.identifier.inchi | InChI=1S/C33H32N6O4/c34-25(13-19-16-35-26-10-4-1-7-22(19)26)31(40)38-29(14-20-17-36-27-11-5-2-8-23(20)27)32(41)39-30(33(42)43)15-21-18-37-28-12-6-3-9-24(21)28/h1-12,16-18,25,29-30,35-37H,13-15,34H2,(H,38,40)(H,39,41)(H,42,43)/t25-,29-,30-/m0/s1 | |
dc.identifier.ichi | C33H32N6O4,34H2-31H(16H2-19-13H-35H-25-10H-4H-1H-7H-22(19)25)28(40)38H-32H(17H2-20-14H-36H-26-11H-5H-2H-8H-23(20)26)29(41)39H-33H(30(42)43H)18H2-21-15H-37H-27-12H-6H-3H-9H-24(21)27 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules