NSC255110
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T13:17:31Z | |
dc.date.available | 2006-04-28T13:17:31Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T13:17:31Z | |
dc.identifier | NSC255110 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/152390 | |
dc.format.extent | 13613 bytes | |
dc.format.extent | 10791 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC255110 | en_GB |
dc.title.alternative | 19-Formylgeldanamycin N',N'-dimethyl-hydrazone | en_GB |
dc.title.alternative | 19-Formylgeldanamycin-N',N'-dimethylhydrazone | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | CWGFPMGPQDJKNJ-YKJWRMJYSA-N | |
dc.identifier.inchi | InChI=1S/C32H46N4O9/c1-17-13-21-27(38)25(22(16-34-36(5)6)28(39)30(21)44-9)35-31(40)18(2)11-10-12-23(42-7)29(45-32(33)41)20(4)15-19(3)26(37)24(14-17)43-8/h10-12,15-17,19,23-24,26,29,37H,13-14H2,1-9H3,(H2,33,41)(H,35,40)/b12-10-,18-11+,20-15+,34-16+/t17-,19+,23+,24-,26+,29-/m0/s1 | |
dc.identifier.ichi | C32H46N4O9,1H3-17-11H-10H-12H-29H(43-8H3)31H(45-26(33H2)40)18(2H3)13H-27H(3H3)32H(41H)30H(44-9H3)16H2-28H(4H3)15H2-20-23(38)21(35H-25(17)39)19(14H-34-36(5H3)6H3)22(37)24(20)42-7H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules