NSC258322
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T13:45:22Z | |
dc.date.available | 2006-04-28T13:45:22Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T13:45:22Z | |
dc.identifier | NSC258322 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/152755 | |
dc.format.extent | 7593 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC258322 | en_GB |
dc.title.alternative | Asperuloside | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | IBIPGYWNOBGEMH-HPCGYMDGSA-N | |
dc.identifier.inchi | InChI=1S/C18H22O11/c1-6(20)25-4-7-2-9-12-8(16(24)27-9)5-26-17(11(7)12)29-18-15(23)14(22)13(21)10(3-19)28-18/h2,5,9-15,17-19,21-23H,3-4H2,1H3/t9-,10-,11+,12-,13-,14-,15-,17+,18+/m0/s1 | |
dc.identifier.ichi | C18H22O11,1H3-6(19)26-4H2-7-2H-10H-13H-8(9(20)27-10)3H-25-17H(12H(7)13)29-18H-16H(24H)15H(23H)14H(22H)11H(5H2-21H)28-18 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules