NSC265473
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T15:15:57Z | |
dc.date.available | 2006-04-28T15:15:57Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T15:15:57Z | |
dc.identifier | NSC265473 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/154181 | |
dc.format.extent | 9763 bytes | |
dc.format.extent | 8152 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC265473 | en_GB |
dc.title.alternative | 2-Propenamide, N-[2-(decylthio)-1-(hydroxymethyl)ethyl]-3-(1,2,3, 4-tetrahydro-6-methyl-2,4-dioxo-5-pyrimidinyl)-, (E)-(.+-.)- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | DEXMFKROHRYHOD-FLVLSHQESA-N | |
dc.identifier.inchi | InChI=1S/C21H35N3O4S/c1-3-4-5-6-7-8-9-10-13-29-15-17(14-25)23-19(26)12-11-18-16(2)22-21(28)24-20(18)27/h11-12,17,25H,3-10,13-15H2,1-2H3,(H,23,26)(H2,22,24,27,28)/b12-11+/t17-/m0/s1 | |
dc.identifier.ichi | C21H35N3O4S,1H3-5H2-6H2-7H2-8H2-9H2-10H2-11H2-12H2-13H2-29-15H2-21H(14H2-28H)24H-18(25)4H-3H-17-16(2H3)22H-20(27)23H-19(17)26 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules