NSC267701
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T16:02:38Z | |
dc.date.available | 2006-04-28T16:02:38Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T16:02:38Z | |
dc.identifier | NSC267701 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/154851 | |
dc.format.extent | 10048 bytes | |
dc.format.extent | 8307 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC267701 | en_GB |
dc.title.alternative | Carbamic acid, butyl-, [5-(3,4-dichlorophenyl)-2, 3-dihydro-1H-pyrrolizine-6,7-diyl]bis(methylene)ester | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QAICVSDGPAJYKW-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C25H33Cl2N3O4/c1-3-5-11-28-24(31)33-15-18-19(16-34-25(32)29-12-6-4-2)23(30-13-7-8-22(18)30)17-9-10-20(26)21(27)14-17/h9-10,14H,3-8,11-13,15-16H2,1-2H3,(H,28,31)(H,29,32) | |
dc.identifier.ichi | C25H33Cl2N3O4,1H3-6H2-8H2-12H2-28H-24(31)33-15H2-20-21(16H2-34-25(32)29H-13H2-9H2-7H2-2H3)23(30-14H2-10H2-11H2-22(20)30)17-3H-4H-18(26)19(27)5H-17 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules