NSC268332
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T16:20:37Z | |
dc.date.available | 2006-04-28T16:20:37Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T16:20:37Z | |
dc.identifier | NSC268332 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/154968 | |
dc.format.extent | 7154 bytes | |
dc.format.extent | 6359 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC268332 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | MLGJHWVEPWZAAV-HYARGMPZSA-N | |
dc.identifier.inchi | InChI=1S/C20H21ClN4O2/c1-2-3-6-13-24-19-8-5-4-7-17(19)18(20(24)21)14-22-23-15-9-11-16(12-10-15)25(26)27/h4-5,7-12,14,23H,2-3,6,13H2,1H3/b22-14+ | |
dc.identifier.ichi | C20H21ClN4O2,1H3-11H2-12H2-13H2-14H2-24-19-5H-3H-2H-4H-17(19)18(20(24)21)10H-22-23H-15-6H-8H-16(9H-7H-15)25(26)27 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules