NSC268658
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T16:26:41Z | |
dc.date.available | 2006-04-28T16:26:41Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T16:26:41Z | |
dc.identifier | NSC268658 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/155104 | |
dc.format.extent | 5895 bytes | |
dc.format.extent | 5388 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC268658 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | PLYHFFKKARTMJA-GSXSUKHASA-N | |
dc.identifier.inchi | InChI=1S/C9H11N3O5.2CH3.Sn/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8;;;/h1-2,4,6-8,13H,3H2,(H2,10,11,16);2*1H3;/q-2;;;+2/t4-,6-,7-,8+;;;/m0.../s1 | |
dc.identifier.ichi | C11H17N3O5Sn,1H3-20(2H3)18-9H-8H(5H2-16H)17-11H(10H(9)19-20)14-4H-3H-6(12H2)13-7(14)15 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules