NSC269161
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T08:58:09Z | |
dc.date.available | 2006-05-02T08:58:09Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T08:58:09Z | |
dc.identifier | NSC269161 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/155287 | |
dc.format.extent | 4310 bytes | |
dc.format.extent | 4663 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC269161 | en_GB |
dc.title.alternative | Phosphoramidous acid, diethyl-, cyclic propylene ester (8CI) | en_GB |
dc.title.alternative | Phosphoramidous acid, N,N-diethyl-, cyclic propylene ester | en_GB |
dc.title.alternative | WLN: T6OPOTJ BN2&2 | en_GB |
dc.title.alternative | 1,3,2-Dioxaphospholan-2-amine, N, N-diethyl-4-methyl- (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | FNCVXAXAHOPRKH-WRWORJQWSA-N | |
dc.identifier.inchi | InChI=1S/C7H16NO2P/c1-4-8(5-2)11-9-6-7(3)10-11/h7H,4-6H2,1-3H3/t7-,11+/m0/s1 | |
dc.identifier.ichi | C7H16NO2P,1H3-4H2-8(5H2-2H3)11-9-6H2-7H(3H3)10-11 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules