NSC271953
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T09:45:41Z | |
dc.date.available | 2006-05-02T09:45:41Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T09:45:41Z | |
dc.identifier | NSC271953 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/156178 | |
dc.format.extent | 5317 bytes | |
dc.format.extent | 5102 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC271953 | en_GB |
dc.title.alternative | 4H-[1,3]Dioxolo[4,5-j]pyrido[3,2,1-de]phenanthridinium, 5, 6-dihydro-, chloride | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QXHDQLNMOSMTIV-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C17H14NO2/c1-3-11-4-2-6-18-9-12-7-15-16(20-10-19-15)8-14(12)13(5-1)17(11)18/h1,3,5,7-9H,2,4,6,10H2/q+1 | |
dc.identifier.ichi | C17H14NO2,1H-2H-12-8H2-7H2-9H2-18-6H-11-4H-15-16(20-10H2-19-15)5H-14(11)13(3H-1)17(12)18 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules