NSC276360
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T10:42:53Z | |
dc.date.available | 2006-05-02T10:42:53Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T10:42:53Z | |
dc.identifier | NSC276360 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/156764 | |
dc.format.extent | 7327 bytes | |
dc.format.extent | 6465 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC276360 | en_GB |
dc.title.alternative | 1H-Pyrrole-3,4-dimethanol, 1-(4-fluorophenyl)-2,5-dimethyl-, bis(methylcarbamate) (ester) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NCIZRAFWXRLBKF-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C18H22FN3O4/c1-11-15(9-25-17(23)20-3)16(10-26-18(24)21-4)12(2)22(11)14-7-5-13(19)6-8-14/h5-8H,9-10H2,1-4H3,(H,20,23)(H,21,24) | |
dc.identifier.ichi | C18H22FN3O4,1H3-11-15(9H2-25-17(23)20H-3H3)16(10H2-26-18(24)21H-4H3)12(2H3)22(11)14-7H-5H-13(19)6H-8H-14 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules