NSC278212
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T11:03:11Z | |
dc.date.available | 2006-05-02T11:03:11Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T11:03:11Z | |
dc.identifier | NSC278212 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/157165 | |
dc.format.extent | 8341 bytes | |
dc.format.extent | 7154 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC278212 | en_GB |
dc.title.alternative | Carbamic acid, ethyl-, [5-(4-fluorophenyl)-2, 3-dihydro-1H-pyrrolizine-6,7-diyl]bis(methylene) ester | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | PPNJQCJYIVNVTH-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C21H26FN3O4/c1-3-23-20(26)28-12-16-17(13-29-21(27)24-4-2)19(25-11-5-6-18(16)25)14-7-9-15(22)10-8-14/h7-10H,3-6,11-13H2,1-2H3,(H,23,26)(H,24,27) | |
dc.identifier.ichi | C21H26FN3O4,1H3-7H2-23H-20(26)28-12H2-16-17(13H2-29-21(27)24H-8H2-2H3)19(25-11H2-9H2-10H2-18(16)25)14-3H-5H-15(22)6H-4H-14 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules