NSC280793
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T12:30:07Z | |
dc.date.available | 2006-05-02T12:30:07Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T12:30:07Z | |
dc.identifier | NSC280793 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/157797 | |
dc.format.extent | 4668 bytes | |
dc.format.extent | 4769 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC280793 | en_GB |
dc.title.alternative | Cinnamaldehyde, 3,4,5-trimethoxy- (8CI) | en_GB |
dc.title.alternative | 2-Propenal, 3-(3,4, 5-trimethoxyphenyl)- (9CI) | en_GB |
dc.title.alternative | 3,4,5-Trimethoxycinnamaldehyde | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | XDSHNNRBLSBDAP-SNAWJCMRSA-N | |
dc.identifier.inchi | InChI=1S/C12H14O4/c1-14-10-7-9(5-4-6-13)8-11(15-2)12(10)16-3/h4-8H,1-3H3/b5-4+ | |
dc.identifier.ichi | C12H14O4,1H3-14-10-7H-9(5H-4H-6H-13)8H-11(15-2H3)12(10)16-3H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules