NSC280838
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T12:32:17Z | |
dc.date.available | 2006-05-02T12:32:17Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T12:32:17Z | |
dc.identifier | NSC280838 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/157842 | |
dc.format.extent | 6697 bytes | |
dc.format.extent | 5953 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC280838 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NMUBLEHIFUIDAZ-SUMWQHHRSA-N | |
dc.identifier.inchi | InChI=1S/C17H20N2O4/c1-11(2)17-8-13(10-22-9-12-6-4-3-5-7-12)23-15(17)19-16(21)18-14(17)20/h3-7,11,13H,8-10H2,1-2H3,(H,18,20,21)/t13-,17+/m0/s1 | |
dc.identifier.ichi | C17H20N2O4,1H3-15H(2H3)17-9H2-16H(10H2-22-8H2-11-6H-4H-3H-5H-7H-11)23-12(17)18-14(21)19H-13(17)20 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules