NSC282054
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T13:02:12Z | |
dc.date.available | 2006-05-02T13:02:12Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T13:02:12Z | |
dc.identifier | NSC282054 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/158429 | |
dc.format.extent | 2384 bytes | |
dc.format.extent | 3046 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC282054 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ZDTJZRPVNVIAIV-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C3H5N5O/c4-2(9)1-3-5-7-8-6-3/h1H2,(H2,4,9)(H,5,6,7,8) | |
dc.identifier.ichi | C3H5N5O,4H2-2(9)1H2-3-5-6-7-8H-3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules