NSC287066
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T14:23:12Z | |
dc.date.available | 2006-05-02T14:23:12Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T14:23:12Z | |
dc.identifier | NSC287066 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/159274 | |
dc.format.extent | 10489 bytes | |
dc.format.extent | 8823 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC287066 | en_GB |
dc.title.alternative | Lappaol A | en_GB |
dc.title.alternative | LAPPAOL A | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | PYLYQTVVQXPBIJ-KBENKGRVSA-N | |
dc.identifier.inchi | InChI=1S/C30H32O9/c1-35-25-11-16(4-6-23(25)32)9-20-19(15-38-30(20)34)8-17-10-21-22(14-31)28(39-29(21)27(12-17)37-3)18-5-7-24(33)26(13-18)36-2/h4-7,10-13,19-20,22,28,31-33H,8-9,14-15H2,1-3H3/t19-,20+,22+,28-/m1/s1 | |
dc.identifier.ichi | C30H32O9,1H3-35-22-9H-16(4H-6H-20(22)33H)13H2-28H-26(31)38-15H2-27H(28)12H2-17-8H-19-25(24(10H-17)37-3H3)39-30H(29H(19)14H2-32H)18-5H-7H-21(34H)23(11H-18)36-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules