NSC287296
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T14:24:26Z | |
dc.date.available | 2006-05-02T14:24:26Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T14:24:26Z | |
dc.identifier | NSC287296 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/159302 | |
dc.format.extent | 8009 bytes | |
dc.format.extent | 7096 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC287296 | en_GB |
dc.title.alternative | 1H-Pyrido[3,4-b]indole, 1-(2,6-dimethyl-5-heptenyl)-2,3,4, 9-tetrahydro-6-methoxy-, monohydrochloride | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | MKQRUPCSMDQKBM-YWZLYKJASA-N | |
dc.identifier.inchi | InChI=1S/C21H30N2O/c1-14(2)6-5-7-15(3)12-20-21-17(10-11-22-20)18-13-16(24-4)8-9-19(18)23-21/h6,8-9,13,15,20,22-23H,5,7,10-12H2,1-4H3/t15-,20-/m0/s1 | |
dc.identifier.ichi | C21H30N2O,1H3-14(2H3)7H-9H2-11H2-20H(3H3)13H2-21H-19-18(10H2-12H2-22H-21)16-8H-15(24-4H3)5H-6H-17(16)23H-19 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules