NSC288031
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T14:36:53Z | |
dc.date.available | 2006-05-02T14:36:53Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T14:36:53Z | |
dc.identifier | NSC288031 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/159521 | |
dc.format.extent | 6650 bytes | |
dc.format.extent | 6012 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC288031 | en_GB |
dc.title.alternative | DOMOIC ACID | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VZFRNCSOCOPNDB-JIUSADRUSA-N | |
dc.identifier.inchi | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-5,9-11,13,16H,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b5-3+,8-4+/t9-,10+,11-,13+/m1/s1 | |
dc.identifier.ichi | C15H21NO6,1H3-8(4H-3H-5H-12H(2H3)10(18)21H)13H-7H2-16H-15H(11(19)22H)14H(13)6H2-9(17)20H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules