NSC289524
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T14:59:28Z | |
dc.date.available | 2006-05-02T14:59:28Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T14:59:28Z | |
dc.identifier | NSC289524 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/159953 | |
dc.format.extent | 8271 bytes | |
dc.format.extent | 7058 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC289524 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NTXFUSSIFLLBCE-QGZVFWFLSA-N | |
dc.identifier.inchi | InChI=1S/C22H22N4O6/c23-22-25-16-8-5-13(11-15(16)20(30)26-22)2-1-12-3-6-14(7-4-12)19(29)24-17(21(31)32)9-10-18(27)28/h3-8,11,17H,1-2,9-10H2,(H,24,29)(H,27,28)(H,31,32)(H3,23,25,26,30)/t17-/m1/s1 | |
dc.identifier.ichi | C22H22N4O6,23H2-21-24-16-6H-3H-13(7H-15(16)18(31H)25-21)9H2-8H2-12-1H-4H-14(5H-2H-12)19(28)26H-22H(20(29)32H)11H2-10H2-17(27)30H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules