NSC293826
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T16:10:08Z | |
dc.date.available | 2006-05-02T16:10:08Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T16:10:08Z | |
dc.identifier | NSC293826 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/161198 | |
dc.format.extent | 5908 bytes | |
dc.format.extent | 5643 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC293826 | en_GB |
dc.title.alternative | Naphtho[1,2-b]furan-2,8(3H,4H)-dione, 7-chloro-3a,5,5a,9,9a, 9b-hexahydro-3,5a,9-trimethyl-, (3.alpha.,3a.alpha.,5a.beta., 9.alpha.,9a.alpha.,9b.beta.)- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | UVDPCUYGHGFZON-LKSFGHJUSA-N | |
dc.identifier.inchi | InChI=1S/C15H19ClO3/c1-7-9-4-5-15(3)6-10(16)12(17)8(2)11(15)13(9)19-14(7)18/h6-9,11,13H,4-5H2,1-3H3/t7-,8-,9-,11+,13-,15-/m0/s1 | |
dc.identifier.ichi | C15H19ClO3,1H3-10H-8(17)7(16)4H-15(3H3)6H2-5H2-12H-11H(2H3)9(18)19-14H(12)13H(10)15 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules