NSC294400
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T16:24:58Z | |
dc.date.available | 2006-05-02T16:24:58Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T16:24:58Z | |
dc.identifier | NSC294400 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/161499 | |
dc.format.extent | 9838 bytes | |
dc.format.extent | 8331 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC294400 | en_GB |
dc.title.alternative | 5,12-Naphthacenedione, 10-[(3-amino-2,3, 6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9, 10-tetrahydro-6,8,11-trihydroxy-1-methoxy-7-methyl-, hydrochloride, [7R-(7.alpha.,8.alpha.,10.beta.)]- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | WUNGUNXTAVGEIY-JJDKVSOCSA-N | |
dc.identifier.inchi | InChI=1S/C26H29NO9/c1-9-13(28)8-15(36-16-7-12(27)22(29)10(2)35-16)19-17(9)24(31)20-21(26(19)33)25(32)18-11(23(20)30)5-4-6-14(18)34-3/h4-6,9-10,12-13,15-16,22,28-29,31,33H,7-8,27H2,1-3H3/t9-,10+,12-,13-,15-,16-,22+/m0/s1 | |
dc.identifier.ichi | C26H29NO9,1H3-20H-14-15(22H(7H2-24H(20)32H)36-25H-8H2-23H(27H2)26H(33H)21H(2H3)35-25)19(31H)13-12(18(14)30H)16(28)9-5H-4H-6H-10(34-3H3)11(9)17(13)29 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules