NSC295100
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2006-05-02T16:43:55Z | |
| dc.date.available | 2006-05-02T16:43:55Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2006-05-02T16:43:55Z | |
| dc.identifier | NSC295100 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/161848 | |
| dc.format.extent | 7189 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC295100 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | MYJMWRXONCJILJ-UHFFFAOYSA-Q | |
| dc.identifier.inchi | InChI=1S/C12H29N3.HI.Pd/c1-5-14(6-2)11-9-13-10-12-15(7-3)8-4;;/h13H,5-12H2,1-4H3;1H;/q;;-6/p+3 | |
| dc.identifier.ichi | C12H33IN3Pd,1H3-5H2-15H(6H2-2H3)11H2-9H2-14H2-10H2-12H2-16H(7H2-3H3,8H2-4H3)17(14,15)13H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules