NSC295268
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T16:45:30Z | |
dc.date.available | 2006-05-02T16:45:30Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T16:45:30Z | |
dc.identifier | NSC295268 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/161884 | |
dc.format.extent | 5888 bytes | |
dc.format.extent | 5606 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC295268 | en_GB |
dc.title.alternative | CARPESIOLIN | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | IOUNDPHKKPZPKB-ACRYUFQLSA-N | |
dc.identifier.inchi | InChI=1S/C15H20O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h7,9-10,12-13,17H,2,4-6H2,1,3H3/t7-,9-,10+,12-,13-,15-/m1/s1 | |
dc.identifier.ichi | C15H20O4,1H2-7-9(17)19-12H-6H2-10H(2H3)11H-5H2-4H2-8(16)15(11,3H3)14H(18H)13H(7)12 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules