NSC295518
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2006-05-02T16:53:03Z | |
| dc.date.available | 2006-05-02T16:53:03Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2006-05-02T16:53:03Z | |
| dc.identifier | NSC295518 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/162050 | |
| dc.format.extent | 4393 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC295518 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | FHZDWTLRBBGVDY-UHFFFAOYSA-P | |
| dc.identifier.inchi | InChI=1S/C6H14N2.2ClH.Pt/c1-7-3-5-8(2)6-4-7;;;/h3-6H2,1-2H3;2*1H;/q;;;-6/p+2 | |
| dc.identifier.ichi | C6H18Cl2N2Pt,1H3-9H-3H2-5H2-10H(2H3,6H2-4H2-9)11(9,7H)8H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules