NSC297289
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-03T09:08:26Z | |
dc.date.available | 2006-05-03T09:08:26Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-03T09:08:26Z | |
dc.identifier | NSC297289 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/162489 | |
dc.format.extent | 10839 bytes | |
dc.format.extent | 8994 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC297289 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | REOKYDMLWRVBHJ-HDICACEKSA-N | |
dc.identifier.inchi | InChI=1S/C22H42N4O6/c23-17(21(29)30)11-7-9-15-25-19(27)13-5-3-1-2-4-6-14-20(28)26-16-10-8-12-18(24)22(31)32/h17-18H,1-16,23-24H2,(H,25,27)(H,26,28)(H,29,30)(H,31,32)/t17-,18+ | |
dc.identifier.ichi | C22H42N4O6,23H2-21H(19(29)31H)13H2-7H2-9H2-15H2-25H-17(27)11H2-5H2-3H2-1H2-2H2-4H2-6H2-12H2-18(28)26H-16H2-10H2-8H2-14H2-22H(24H2)20(30)32H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules