NSC297390
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-03T09:12:14Z | |
dc.date.available | 2006-05-03T09:12:14Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-03T09:12:14Z | |
dc.identifier | NSC297390 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/162572 | |
dc.format.extent | 4380 bytes | |
dc.format.extent | 4456 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC297390 | en_GB |
dc.title.alternative | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro-3-(tetrahydro-2H-pyran-2-yl)- (9CI) | en_GB |
dc.title.alternative | 5-Fluoro-3-(tetrahydropyran-2-yl)uracil | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | LIVRXWIFPFKXFO-SSDOTTSWSA-N | |
dc.identifier.inchi | InChI=1S/C9H11FN2O3/c10-6-5-11-9(14)12(8(6)13)7-3-1-2-4-15-7/h5,7H,1-4H2,(H,11,14)/t7-/m1/s1 | |
dc.identifier.ichi | C9H11FN2O3,10-6-1H-11H-8(14)12(7(6)13)9H-4H2-2H2-3H2-5H2-15-9 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules