NSC298842
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-03T09:40:26Z | |
dc.date.available | 2006-05-03T09:40:26Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-03T09:40:26Z | |
dc.identifier | NSC298842 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/163129 | |
dc.format.extent | 10859 bytes | |
dc.format.extent | 9119 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC298842 | en_GB |
dc.title.alternative | .beta.-D-arabino-Hexopyranose, 2-deoxy-1-thio-, 3,4,6-benzoate 1-[ethyl(2-hydroxyethyl)arsinite] | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | CYARRVUANBQHTP-JNFAHBAPSA-N | |
dc.identifier.inchi | InChI=1S/C31H33AsO8S/c1-2-32(18-19-33)41-27-20-25(39-30(35)23-14-8-4-9-15-23)28(40-31(36)24-16-10-5-11-17-24)26(38-27)21-37-29(34)22-12-6-3-7-13-22/h3-17,25-28,33H,2,18-21H2,1H3/t25-,26-,27+,28-,32-/m0/s1 | |
dc.identifier.ichi | C31H33AsO8S,1H3-17H2-32(18H2-19H2-36H)41-30H-20H2-28H(38-26(34)23-13H-7H-3H-8H-14H-23)31H(39-27(35)24-15H-9H-4H-10H-16H-24)29H(40-30)21H2-37-25(33)22-11H-5H-2H-6H-12H-22 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules