NSC12575
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-01-24T11:18:26Z | |
dc.date.available | 2005-01-24T11:18:26Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-01-24T11:18:26Z | |
dc.identifier | NSC12575 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/17128 | |
dc.format.extent | 2215 bytes | |
dc.format.extent | 3065 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC12575 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QZRLVTAIVZRZQH-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C4H4N4O2/c5-1-3-7(4-2-6)8(9)10/h3-4H2 | |
dc.identifier.ichi | C4H4N4O2,5-1-3H2-7(4H2-2-6)8(9)10 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules