NSC175
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-11-25T12:15:20Z | |
dc.date.available | 2004-11-25T12:15:20Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-11-25T12:15:20Z | |
dc.identifier | NSC175 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/1730 | |
dc.format.extent | 2275 bytes | |
dc.format.extent | 3086 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC175 | en_GB |
dc.title.alternative | .alpha.,.beta.-Dibromopropionic acid | en_GB |
dc.title.alternative | Propanoic acid, 2, 3-dibromo- (9CI) | en_GB |
dc.title.alternative | Propionic acid, 2,3-dibromo- (8CI) | en_GB |
dc.title.alternative | 2, 3-Dibromopropanoic acid | en_GB |
dc.title.alternative | 2,3-Dibromopropionic acid | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ZMYAKSMZTVWUJB-UWTATZPHSA-N | |
dc.identifier.inchi | InChI=1S/C3H4Br2O2/c4-1-2(5)3(6)7/h2H,1H2,(H,6,7)/t2-/m1/s1 | |
dc.identifier.ichi | C3H4Br2O2,4-1H2-3H(5)2(6)7H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules