NSC15193
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-01-24T12:56:07Z | |
dc.date.available | 2005-01-24T12:56:07Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-01-24T12:56:07Z | |
dc.identifier | NSC15193 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/19416 | |
dc.format.extent | 3633 bytes | |
dc.format.extent | 4166 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC15193 | en_GB |
dc.title.alternative | D-arabino-Hexose, 2-deoxy- (8CI 9CI) | en_GB |
dc.title.alternative | Ba 2758 | en_GB |
dc.title.alternative | D-Glucose, 2-deoxy- | en_GB |
dc.title.alternative | WLN: VH1YQYQYQ1Q-D-ARABINO | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VRYALKFFQXWPIH-NGJCXOISSA-N | |
dc.identifier.inchi | InChI=1S/C6H12O5/c7-2-1-4(9)6(11)5(10)3-8/h2,4-6,8-11H,1,3H2/t4-,5+,6-/m1/s1 | |
dc.identifier.ichi | C6H12O5,7-1H-2H2-4H(9H)6H(11H)5H(10H)3H2-8H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules