NSC1867
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-11-25T13:00:03Z | |
dc.date.available | 2004-11-25T13:00:03Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-11-25T13:00:03Z | |
dc.identifier | NSC1867 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/3347 | |
dc.format.extent | 5139 bytes | |
dc.format.extent | 5114 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC1867 | en_GB |
dc.title.alternative | Phenyl 1-hydroxy-2-naphthalenecarboxylate | en_GB |
dc.title.alternative | Phenyl 1-hydroxy-2-naphthoate | en_GB |
dc.title.alternative | 1-Hydroxy-2-naphthoic acid phenyl ester | en_GB |
dc.title.alternative | 2-Naphthalenecarboxylic acid, 1-hydroxy-, phenyl ester (9CI) | en_GB |
dc.title.alternative | 2-Naphthoic acid, 1-hydroxy-, phenyl ester (8CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QHDYIMWKSCJTIM-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C17H12O3/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13/h1-11,18H | |
dc.identifier.ichi | C17H12O3,18-17(20-13-7H-2H-1H-3H-8H-13)15-11H-10H-12-6H-4H-5H-9H-14(12)16(15)19H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules