NSC1985
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-11-25T13:03:30Z | |
dc.date.available | 2004-11-25T13:03:30Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-11-25T13:03:30Z | |
dc.identifier | NSC1985 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/3465 | |
dc.format.extent | 3748 bytes | |
dc.format.extent | 4292 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC1985 | en_GB |
dc.title.alternative | .alpha.-Bromomalonic ester | en_GB |
dc.title.alternative | Bromomalonic acid diethyl ester | en_GB |
dc.title.alternative | Diethyl .alpha.-bromomalonate | en_GB |
dc.title.alternative | Diethyl bromomalonate | en_GB |
dc.title.alternative | Diethyl 2-bromomalonate | en_GB |
dc.title.alternative | Ethyl bromomalonate | en_GB |
dc.title.alternative | Malonic acid, bromo-, diethyl ester | en_GB |
dc.title.alternative | Propanedioic acid, bromo-, diethyl ester (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | FNJVDWXUKLTFFL-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C7H11BrO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3 | |
dc.identifier.ichi | C7H11BrO4,1H3-3H2-11-5(9)7H(8)6(10)12-4H2-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules