NSC3139
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-12T18:01:28Z | |
dc.date.available | 2004-12-12T18:01:28Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-12T18:01:28Z | |
dc.identifier | NSC3139 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/4586 | |
dc.format.extent | 2618 bytes | |
dc.format.extent | 3348 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC3139 | en_GB |
dc.title.alternative | .beta.-Hydroxyethyl carbamate | en_GB |
dc.title.alternative | Carbamic acid, 2-hydroxyethyl ester | en_GB |
dc.title.alternative | Ethylene glycol, monocarbamate (8CI) | en_GB |
dc.title.alternative | Hydroxyethyl carbamate | en_GB |
dc.title.alternative | WLN: ZVO2Q | en_GB |
dc.title.alternative | 1,2-Ethanediol, monocarbamate (9CI) | en_GB |
dc.title.alternative | 2-Hydroxyethyl carbamate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | BTDQXGUEVVTAMD-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C3H7NO3/c4-3(6)7-2-1-5/h5H,1-2H2,(H2,4,6) | |
dc.identifier.ichi | C3H7NO3,4H2-3(5)7-2H2-1H2-6H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules