NSC47786
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-22T11:58:29Z | |
dc.date.available | 2005-08-22T11:58:29Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-22T11:58:29Z | |
dc.identifier | NSC47786 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/48145 | |
dc.format.extent | 6459 bytes | |
dc.format.extent | 5869 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC47786 | en_GB |
dc.title.alternative | 9H-Purin-2-amine, 6-[[(2, 4-dichlorophenyl)methyl]thio]-9-(2-methylpropyl)- | en_GB |
dc.title.alternative | 9H-Purine, 2-amino-6-(2,4-dichlorobenzylthio)-9-isobutyl- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | MLXSKOFAXKBMOL-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C16H17Cl2N5S/c1-9(2)6-23-8-20-13-14(23)21-16(19)22-15(13)24-7-10-3-4-11(17)5-12(10)18/h3-5,8-9H,6-7H2,1-2H3,(H2,19,21,22) | |
dc.identifier.ichi | C16H17Cl2N5S,1H3-16H(2H3)8H2-23-6H-20-12-13(23)21-15(19H2)22-14(12)24-7H2-10-4H-3H-9(17)5H-11(10)18 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules