NSC48830
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-22T12:50:48Z | |
dc.date.available | 2005-08-22T12:50:48Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-22T12:50:48Z | |
dc.identifier | NSC48830 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/48865 | |
dc.format.extent | 2695 bytes | |
dc.format.extent | 3325 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC48830 | en_GB |
dc.title.alternative | 2-Butenedioic acid, 2-methyl-, cyclic hydrazide, (Z)- | en_GB |
dc.title.alternative | 3, 6-Dihydroxy-4-methylpyridazine | en_GB |
dc.title.alternative | 3,6-Pyridazinedione, 1, 2-dihydro-4-methyl- (8CI9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QAVYOWFNXMHVEL-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C5H6N2O2/c1-3-2-4(8)6-7-5(3)9/h2H,1H3,(H,6,8)(H,7,9) | |
dc.identifier.ichi | C5H6N2O2,1H3-3-2H-4(8)6H-7H-5(3)9 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules