NSC50152
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-22T13:47:52Z | |
dc.date.available | 2005-08-22T13:47:52Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-22T13:47:52Z | |
dc.identifier | NSC50152 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/49786 | |
dc.format.extent | 5197 bytes | |
dc.format.extent | 5102 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC50152 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NSXBROVJPCGNBU-HNNXBMFYSA-N | |
dc.identifier.inchi | InChI=1S/C16H14O4/c1-18-13-8-7-10(9-14(13)19-2)15-11-5-3-4-6-12(11)16(17)20-15/h3-9,15H,1-2H3/t15-/m0/s1 | |
dc.identifier.ichi | C16H14O4,1H3-18-13-8H-7H-10(9H-14(13)19-2H3)16H-12-6H-4H-3H-5H-11(12)15(17)20-16 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules